AB54178
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $23.00 | $16.00 | - + | |
5g | 98% | in stock | $40.00 | $28.00 | - + | |
10g | 98% | in stock | $68.00 | $47.00 | - + | |
25g | 98% | in stock | $136.00 | $95.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54178 |
Chemical Name: | 2,4,6-Trichlorobenzoyl chloride |
CAS Number: | 4136-95-2 |
Molecular Formula: | C7H2Cl4O |
Molecular Weight: | 243.9022 |
MDL Number: | MFCD00075323 |
SMILES: | Clc1cc(Cl)c(c(c1)Cl)C(=O)Cl |
Complexity: | 172 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 4.3 |
The Journal of organic chemistry 20080704