AI50093
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $12.00 | $9.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 95% | in stock | $146.00 | $103.00 | - + | |
500g | 95% | in stock | $636.00 | $445.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50093 |
Chemical Name: | Alpha-sulfophenylacetic acid |
CAS Number: | 41360-32-1 |
Molecular Formula: | C8H8O5S |
Molecular Weight: | 216.2111 |
MDL Number: | MFCD09952336 |
SMILES: | OC(=O)C(S(=O)(=O)O)c1ccccc1 |
Complexity: | 296 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 0.4 |
Journal of medicinal chemistry 20031120
Journal of medicinal chemistry 20020606
The Journal of antibiotics 19810101