logo
Home  > 10-Oxooctadecanoic acid

AB51544

4158-12-7 | 10-Oxooctadecanoic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $332.00 $232.00 -   +
1g 95% in stock $820.00 $574.00 -   +
5g 95% in stock $2,392.00 $1,674.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB51544
Chemical Name: 10-Oxooctadecanoic acid
CAS Number: 4158-12-7
Molecular Formula: C18H34O3
Molecular Weight: 298.4608
MDL Number: MFCD08693365
SMILES: CCCCCCCCC(=O)CCCCCCCCC(=O)O

 

Upstream Synthesis Route
  • 10-Oxooctadecanoic acid, also known as 10-oxostearic acid, is a key compound widely utilized in chemical synthesis processes. This chemical plays a crucial role in various applications due to its versatile nature and unique properties.In chemical synthesis, 10-oxooctadecanoic acid serves as a valuable precursor for the production of various derivatives and functionalized molecules. Its carbonyl group and long carbon chain enable it to participate in a wide range of organic reactions, including esterification, hydrogenation, amidation, and oxidation processes.One significant application of 10-oxooctadecanoic acid is in the synthesis of surfactants and emulsifiers. By modifying the carboxylic acid moiety or introducing functional groups onto the carbon chain, chemists can tailor the properties of the resulting compounds for specific applications in industries such as cosmetics, pharmaceuticals, and textiles.Furthermore, 10-oxooctadecanoic acid can be utilized in the production of specialty chemicals, including polymer additives, lubricants, and corrosion inhibitors. Its structure provides a platform for the design and synthesis of novel compounds with desired functionalities, making it a valuable building block in the chemical industry.Overall, the versatility and reactivity of 10-oxooctadecanoic acid make it an essential component in chemical synthesis for the creation of a diverse range of compounds with varying applications and properties.
FEATURED PRODUCTS