AB52983
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $12.00 | $9.00 | - + | |
25g | 98% | in stock | $57.00 | $40.00 | - + | |
100g | 98% | in stock | $147.00 | $103.00 | - + | |
500g | 98% | in stock | $605.00 | $423.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52983 |
Chemical Name: | 1,2,3,4,6-Penta-O-acetyl-alpha-D-mannopyranose |
CAS Number: | 4163-65-9 |
Molecular Formula: | C16H22O11 |
Molecular Weight: | 390.3393 |
MDL Number: | MFCD00069798 |
SMILES: | CC(=O)OC[C@H]1O[C@H](OC(=O)C)[C@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Complexity: | 599 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 11 |
Rotatable Bond Count: | 11 |
XLogP3: | 0.6 |
European journal of medicinal chemistry 20080701
Molecules (Basel, Switzerland) 20051031