AB58385
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $43.00 | $30.00 | - + | |
25g | 98% | in stock | $200.00 | $140.00 | - + | |
100g | 98% | in stock | $799.00 | $559.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB58385 |
Chemical Name: | 1H,1H-Perfluoro-1-nonanol |
CAS Number: | 423-56-3 |
Molecular Formula: | C9H3F17O |
Molecular Weight: | 450.0924 |
MDL Number: | MFCD00153183 |
SMILES: | OCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Complexity: | 543 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 18 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 5.3 |
The journal of physical chemistry. B 20051201
The journal of physical chemistry. B 20050901
The journal of physical chemistry. B 20050728