AB72512
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | 2 weeks | $229.00 | $160.00 | - + | |
5mg | 98% | 2 weeks | $675.00 | $473.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB72512 |
Chemical Name: | Dehydrodiconiferyl alcohol |
CAS Number: | 4263-87-0 |
Molecular Formula: | C20H22O6 |
Molecular Weight: | 358.3851 |
MDL Number: | MFCD31544311 |
SMILES: | OC/C=C/c1cc2c(c(c1)OC)OC(C2CO)c1ccc(c(c1)OC)O |
Complexity: | 469 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 1.9 |
Applied and environmental microbiology 20151201
The Journal of biological chemistry 20120316
Archives of pharmacal research 20060701