AB44788
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $22.00 | $15.00 | - + | |
25g | 97% | in stock | $66.00 | $47.00 | - + | |
100g | 97% | in stock | $188.00 | $132.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44788 |
Chemical Name: | 4,6-Dichloro-5-nitropyrimidine |
CAS Number: | 4316-93-2 |
Molecular Formula: | C4HCl2N3O2 |
Molecular Weight: | 193.9756 |
MDL Number: | MFCD00006107 |
SMILES: | [O-][N+](=O)c1c(Cl)ncnc1Cl |
NSC Number: | 89693 |
Complexity: | 152 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 2 |
4,6-Dichloro-5-nitropyrimidine is a versatile compound widely used in chemical synthesis as a key building block for various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure allows it to participate in a range of reactions, making it a valuable intermediate in organic synthesis.In the field of pharmaceuticals, 4,6-Dichloro-5-nitropyrimidine is utilized for the synthesis of antiviral agents, anticancer drugs, and antimicrobial compounds. Its functional groups can be selectively modified to introduce specific properties or enhance biological activity in the final molecule.In agrochemical applications, this compound serves as a precursor for the production of herbicides, insecticides, and fungicides. By incorporating 4,6-Dichloro-5-nitropyrimidine into the molecular structure of these agricultural chemicals, researchers can tailor their properties for targeted pest control and crop protection.Furthermore, in the realm of fine chemicals, 4,6-Dichloro-5-nitropyrimidine is employed in the synthesis of dyes, pigments, and specialty chemicals. Its reactivity and compatibility with various functional groups make it a valuable tool for designing and creating high-value compounds with specific properties.Overall, the strategic role of 4,6-Dichloro-5-nitropyrimidine in chemical synthesis lies in its versatility and utility across diverse industries, where its applications contribute to the development of innovative products with significant commercial and societal impact.
Acta crystallographica. Section E, Structure reports online 20111001
PloS one 20090101
Journal of combinatorial chemistry 20040101
The Journal of organic chemistry 20010126