AI50388
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $24.00 | $17.00 | - + | |
5g | 97% | in stock | $49.00 | $34.00 | - + | |
25g | 97% | in stock | $161.00 | $113.00 | - + | |
100g | 97% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50388 |
Chemical Name: | 1,2-Bis(trifluoromethyl)benzene |
CAS Number: | 433-95-4 |
Molecular Formula: | C8H4F6 |
Molecular Weight: | 214.1078 |
MDL Number: | MFCD03094218 |
SMILES: | C1=CC=C(C(=C1)C(F)(F)F)C(F)(F)F |
Complexity: | 169 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
XLogP3: | 3.7 |
The Journal of organic chemistry 20080321
Chemistry (Weinheim an der Bergstrasse, Germany) 20070101