logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > Fmoc-NH-peg4-CH2COOH

AG29273

437655-95-3 | Fmoc-NH-peg4-CH2COOH

Packsize Purity Availability Price Discounted Price    Quantity
100mg 96% in stock $18.00 $12.00 -   +
250mg 96% in stock $22.00 $15.00 -   +
1g 96% in stock $78.00 $54.00 -   +
10g 96% in stock $758.00 $531.00 -   +
25g 96% in stock $1,504.00 $1,053.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AG29273
Chemical Name: Fmoc-NH-peg4-CH2COOH
CAS Number: 437655-95-3
Molecular Formula: C25H31NO8
Molecular Weight: 473.51554
MDL Number: MFCD26142981
SMILES: OC(=O)COCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2c1cccc2

 

Computed Properties
Complexity: 582  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 34  
Hydrogen Bond Acceptor Count: 8  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 17  
XLogP3: 2.1  

 

 

Upstream Synthesis Route
  • The compound 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid plays a crucial role in chemical synthesis as a key building block for creating complex organic molecules. Its unique structure and functional groups make it a versatile intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials. This compound can be utilized in multi-step organic reactions to introduce specific functionalities or structural motifs into target molecules, allowing for precise manipulation of chemical properties. Its incorporation can lead to the formation of novel compounds with enhanced biological activities, improved physical properties, or tailored chemical reactivity.
FEATURED PRODUCTS