AB43117
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $28.00 | $20.00 | - + | |
500g | 98% | in stock | $389.00 | $272.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43117 |
Chemical Name: | Trimesoyl chloride |
CAS Number: | 4422-95-1 |
Molecular Formula: | C9H3Cl3O3 |
Molecular Weight: | 265.4773 |
MDL Number: | MFCD00000679 |
SMILES: | ClC(=O)c1cc(cc(c1)C(=O)Cl)C(=O)Cl |
1,3,5-Benzenetricarbonyl trichloride is a versatile compound used in various chemical synthesis applications. This reagent is commonly employed in organic chemistry as a powerful acylating agent, enabling the introduction of the trichloromethyl group into a wide range of organic compounds. As a reactive intermediate, 1,3,5-Benzenetricarbonyl trichloride participates in numerous reactions, such as Friedel-Crafts acylation, to form new carbon-carbon bonds and functionalize aromatic systems. Additionally, this compound can undergo substitution reactions with nucleophiles to create complex organic molecules with diverse functionalities. Its unique reactivity and compatibility with a variety of reaction conditions make it a valuable tool for designing and synthesizing novel organic compounds in the field of chemical synthesis.