AG20761
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $28.00 | $19.00 | - + | |
2mg | 98% | in stock | $33.00 | $23.00 | - + | |
5mg | 98% | in stock | $48.00 | $33.00 | - + | |
10mg | 98% | in stock | $65.00 | $45.00 | - + | |
25mg | 98% | in stock | $110.00 | $77.00 | - + | |
50mg | 98% | in stock | $173.00 | $121.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG20761 |
Chemical Name: | Av-412 |
CAS Number: | 451492-95-8 |
Molecular Formula: | C27H28ClFN6O |
Molecular Weight: | 507.0022231999998 |
MDL Number: | MFCD16038939 |
SMILES: | C=CC(=O)Nc1cc2c(ncnc2cc1C#CC(N1CCN(CC1)C)(C)C)Nc1ccc(c(c1)Cl)F |
Complexity: | 850 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.5 |
Bioorganic & medicinal chemistry letters 20130801
Journal of cellular biochemistry 20110901
Cancer science 20090801
Cancer science 20071201