AB49084
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $15.00 | $11.00 | - + | |
5mg | 98% | in stock | $37.00 | $26.00 | - + | |
10mg | 98% | in stock | $55.00 | $38.00 | - + | |
25mg | 95% | in stock | $122.00 | $85.00 | - + | |
50mg | 98% | in stock | $144.00 | $101.00 | - + | |
100mg | 95% | in stock | $232.00 | $162.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49084 |
Chemical Name: | Gw 788388 |
CAS Number: | 452342-67-5 |
Molecular Formula: | C25H23N5O2 |
Molecular Weight: | 425.4824 |
MDL Number: | MFCD20527321 |
SMILES: | O=C(c1ccc(cc1)c1nccc(c1)c1c[nH]nc1c1ccccn1)NC1CCOCC1 |
Complexity: | 605 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.7 |
PLoS neglected tropical diseases 20120601
Bioorganic & medicinal chemistry letters 20110915
American journal of physiology. Heart and circulatory physiology 20100501
Arthritis and rheumatism 20100301
Gastroenterology 20080601
Kidney international 20080301
Toxicologic pathology 20070201
Journal of medicinal chemistry 20060406