AI50636
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $139.00 | $97.00 | - + | |
5g | 98% | in stock | $299.00 | $209.00 | - + | |
25g | 98% | in stock | $760.00 | $532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50636 |
Chemical Name: | 3'-Trifluoromethylacetophenone semicarbazone |
CAS Number: | 454-05-7 |
Molecular Formula: | C10H10F3N3O |
Molecular Weight: | 245.2011 |
MDL Number: | MFCD17588465 |
SMILES: | NC(=O)N/N=C(/c1cccc(c1)C(F)(F)F)\C |
Complexity: | 314 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.7 |
Journal of medicinal chemistry 20020620