AB49907
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $11.00 | $8.00 | - + | |
5g | 97% | in stock | $15.00 | $11.00 | - + | |
10g | 97% | in stock | $19.00 | $14.00 | - + | |
25g | 97% | in stock | $45.00 | $32.00 | - + | |
100g | 97% | in stock | $175.00 | $123.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49907 |
Chemical Name: | 2-Fluoro-5-nitroanisole |
CAS Number: | 454-16-0 |
Molecular Formula: | C7H6FNO3 |
Molecular Weight: | 171.1258 |
MDL Number: | MFCD07782081 |
SMILES: | COc1cc(ccc1F)[N+](=O)[O-] |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
1-Fluoro-2-methoxy-4-nitrobenzene, also known as FMNB, is a versatile chemical reagent widely used in organic synthesis. This compound plays a crucial role in various reactions due to its unique properties.In chemical synthesis, 1-Fluoro-2-methoxy-4-nitrobenzene is commonly employed as a building block in the construction of more complex molecules. Its fluoro and nitro substituents make it a valuable starting material for the introduction of fluorine and nitro groups into organic compounds. Additionally, the methoxy group provides a reactive site for further functionalization, allowing for the creation of diverse chemical structures.FMNB is frequently utilized in the preparation of pharmaceutical intermediates, agrochemicals, and fine chemicals. Its ability to participate in various transformations, such as nucleophilic substitution and palladium-catalyzed cross-coupling reactions, makes it a key component in the synthesis of biologically active compounds and specialty chemicals.Furthermore, 1-Fluoro-2-methoxy-4-nitrobenzene has proven to be a valuable tool in medicinal chemistry research, where the precise manipulation of chemical structures is essential for developing new therapeutic agents. Its versatile reactivity and compatibility with a range of synthetic methodologies make it a sought-after reagent in the field of drug discovery.Overall, the strategic incorporation of 1-Fluoro-2-methoxy-4-nitrobenzene in chemical synthesis enables chemists to access a diverse array of functionalized molecules with potential applications in various industrial sectors.