AB49078
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $15.00 | $10.00 | - + | |
25g | 98% | in stock | $19.00 | $13.00 | - + | |
50g | 98% | in stock | $36.00 | $25.00 | - + | |
100g | 98% | in stock | $72.00 | $50.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49078 |
Chemical Name: | N6-Benzoyladenosine |
CAS Number: | 4546-55-8 |
Molecular Formula: | C17H17N5O5 |
Molecular Weight: | 371.3474 |
MDL Number: | MFCD27977441 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2NC(=O)c1ccccc1 |
Complexity: | 534 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | -0.1 |
N6-Benzoyladenosine is a versatile compound commonly used in chemical synthesis for its ability to act as a protecting group for the N6 amino group of adenosine. This functional group plays a crucial role in modulating reactivity and selectivity during the synthesis of nucleosides, nucleotides, and other bioactive compounds. By shielding the N6 amino group, N6-Benzoyladenosine enables specific site-selective reactions to take place without interference from other functional groups present on the molecule. Additionally, this compound can be selectively removed under mild conditions, allowing for the controlled manipulation of chemical structures in a strategic manner. Its application in chemical synthesis contributes to the development of novel pharmaceuticals, nucleic acid analogs, and other valuable molecules with tailored properties and functions.