AB62183
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $8.00 | $5.00 | - + | |
25g | 98% | in stock | $12.00 | $8.00 | - + | |
100g | 98% | in stock | $15.00 | $10.00 | - + | |
500g | 98% | in stock | $63.00 | $44.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB62183 |
Chemical Name: | 1-Fluoro-2-methyl-4-nitrobenzene |
CAS Number: | 455-88-9 |
Molecular Formula: | C7H6FNO2 |
Molecular Weight: | 155.1264 |
MDL Number: | MFCD00007284 |
SMILES: | [O-][N+](=O)c1ccc(c(c1)C)F |
Complexity: | 157 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 2.8 |
The 1-Fluoro-2-methyl-4-nitrobenzene is a versatile compound widely utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in the creation of various organic molecules and pharmaceuticals. Its chemical structure allows for strategic functionalization, enabling the introduction of different substituents and functional groups to generate a diverse array of products. Additionally, the presence of fluorine, methyl, and nitro groups in the molecule imparts distinct reactivity and selectivity in reactions, making it a valuable tool for synthetic chemists in designing and constructing complex organic compounds. In organic synthesis, 1-Fluoro-2-methyl-4-nitrobenzene plays a crucial role in the development of new materials, agrochemicals, and pharmaceuticals, highlighting its significance in modern chemistry.