logo
Home  > 3,3'-Diiodo-l-thyronine

AB42804

4604-41-5 | 3,3'-Diiodo-l-thyronine

Packsize Purity Availability Price Discounted Price    Quantity
5mg 95% in stock $78.00 $55.00 -   +
100mg 95% in stock $88.00 $61.00 -   +
250mg 95% in stock $172.00 $120.00 -   +
1g 95% in stock $512.00 $358.00 -   +
5g 95% in stock $1,790.00 $1,253.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB42804
Chemical Name: 3,3'-Diiodo-l-thyronine
CAS Number: 4604-41-5
Molecular Formula: C15H13I2NO4
Molecular Weight: 525.077
MDL Number: MFCD01863378
SMILES: OC(=O)[C@H](Cc1ccc(c(c1)I)Oc1ccc(c(c1)I)O)N

 

Computed Properties
Complexity: 385  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 22  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 5  
XLogP3: 1.1  

 

 

Upstream Synthesis Route
  • 3,3'-Diiodo-L-thyronine is a valuable chemical compound that finds wide application in chemical synthesis. As a versatile building block, it is commonly used in the preparation of various thyroid hormone analogs. Its unique structure allows for the modification and manipulation of biological activity, making it a key intermediate in the creation of novel pharmaceuticals and bioactive molecules. In addition, 3,3'-Diiodo-L-thyronine serves as a crucial reagent in organic chemistry reactions, facilitating the synthesis of complex organic compounds with specific stereochemistry and properties. Its role in chemical synthesis extends to the development of drug candidates, agrochemicals, and materials science, highlighting its significance in advancing scientific research and innovation.
Literature
FEATURED PRODUCTS