AB45221
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $5.00 | - + | |
10g | 98% | in stock | $11.00 | $8.00 | - + | |
25g | 98% | in stock | $19.00 | $14.00 | - + | |
500g | 98% | in stock | $341.00 | $239.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45221 |
Chemical Name: | 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene |
CAS Number: | 461432-23-5 |
Molecular Formula: | C15H14BrClO |
Molecular Weight: | 325.6281 |
MDL Number: | MFCD11042292 |
SMILES: | CCOc1ccc(cc1)Cc1cc(Br)ccc1Cl |
Complexity: | 241 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 5.5 |
5-bromo-2-chloro-4'-ethoxydiphenylmethane is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. In organic synthesis, this compound serves as a valuable building block for the construction of various complex molecules. Its bromine and chlorine substituents confer distinct reactivity patterns, making it an essential reagent in the synthesis of pharmaceuticals, agrochemicals, and materials science. By strategically manipulating the chemical structure of 5-bromo-2-chloro-4'-ethoxydiphenylmethane, chemists can access a broad range of functionalized derivatives with diverse applications in the field of organic chemistry. The compound's ethoxy group further enhances its utility by providing a convenient handle for further transformations, enabling the synthesis of novel compounds with tailored properties. Overall, 5-bromo-2-chloro-4'-ethoxydiphenylmethane plays a crucial role in modern chemical synthesis as a key intermediate for the construction of complex organic molecules.