AI50752
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | in stock | $6.00 | $4.00 | - + | ||
25mg | in stock | $10.00 | $7.00 | - + | ||
100mg | in stock | $14.00 | $10.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50752 |
Chemical Name: | Bekanamycin |
CAS Number: | 4696-76-8 |
Molecular Formula: | C18H37N5O10 |
Molecular Weight: | 483.5139 |
MDL Number: | MFCD28390297 |
SMILES: | OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@@H]([C@H]([C@@H]2O)O[C@H]2O[C@H](CN)[C@H]([C@@H]([C@H]2N)O)O)N)[C@@H]([C@H]([C@@H]1O)N)O |
Complexity: | 639 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 15 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 15 |
Hydrogen Bond Donor Count: | 11 |
Rotatable Bond Count: | 6 |
XLogP3: | -7.2 |
PloS one 20130101
Bioorganic & medicinal chemistry letters 20120715
Nature chemical biology 20111009
Bioorganic & medicinal chemistry 20110915
Bioorganic & medicinal chemistry 20110801
Dalton transactions (Cambridge, England : 2003) 20110227
Applied microbiology and biotechnology 20110201
Bioorganic & medicinal chemistry 20110101
The Journal of antibiotics 20101101
Journal of the American Chemical Society 20100901
Bioorganic & medicinal chemistry letters 20100801
Biochemistry 20100518
Bioorganic & medicinal chemistry letters 20100315
Bioorganic & medicinal chemistry letters 20091201
European journal of medicinal chemistry 20091001
Bioorganic & medicinal chemistry 20090901
European journal of medicinal chemistry 20090401
European journal of medicinal chemistry 20090201
Organic & biomolecular chemistry 20090107
Antiviral chemistry & chemotherapy 20080101
Journal of molecular biology 20070525
Electrophoresis 20060501
Journal of pharmaceutical and biomedical analysis 20060303
Journal of medicinal chemistry 20051006
Biochemistry 20041123
Current microbiology 20040801
Organic letters 20040219
Chembiochem : a European journal of chemical biology 20031006
Journal of natural products 20030401
Electrophoresis 20020601
Bioorganic & medicinal chemistry 20011001
Molecules and cells 20010630
Bioorganic & medicinal chemistry letters 20010122
Cell 19930924
Reviews of infectious diseases 19810101
Arzneimittel-Forschung 19800101
Verhandlungen der Deutschen Gesellschaft fur Innere Medizin 19760101