logo
Home  > 3,3'-Dihydroxy-beta,beta-carotene-4,4'-dione

AB51860

472-61-7 | 3,3'-Dihydroxy-beta,beta-carotene-4,4'-dione

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $63.00 $45.00 -   +
5g 95% in stock $216.00 $151.00 -   +
10g 95% in stock $408.00 $285.00 -   +
25g 95% in stock $815.00 $570.00 -   +
100g 95% in stock $2,625.00 $1,837.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB51860
Chemical Name: 3,3'-Dihydroxy-beta,beta-carotene-4,4'-dione
CAS Number: 472-61-7
Molecular Formula: C40H52O4
Molecular Weight: 596.8385
MDL Number: MFCD00672621
SMILES: CC(=CC=CC=C(/C=C/C=C(/C=C/C1=C(C)C(=O)[C@H](CC1(C)C)O)C)C)C=CC=C(C=CC1=C(C)C(=O)[C@H](CC1(C)C)O)C

 

Upstream Synthesis Route 
  • 3,3'-Dihydroxy-beta,beta-carotene-4,4'-dione is a versatile compound frequently utilized in chemical synthesis due to its unique properties. This compound serves as a valuable intermediate in the production of various organic molecules, particularly in the development of pharmaceuticals, agrochemicals, and specialty chemicals. Its structural characteristics make it an excellent building block for synthesizing complex molecules with specific biological activities and functions. In chemical synthesis, 3,3'-Dihydroxy-beta,beta-carotene-4,4'-dione can be employed as a key component in the formation of novel compounds through various reaction pathways, such as oxidative transformations, cyclization reactions, and conjugate additions. Its reactivity and functional groups allow for selective modification and manipulation, enabling chemists to tailor molecular structures for desired properties. This compound's role in chemical synthesis extends to the creation of new materials, drug candidates, and research tools, highlighting its significance in advancing the field of organic chemistry.
FEATURED PRODUCTS