AI50879
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $24.00 | $17.00 | - + | |
250mg | 95% | in stock | $39.00 | $28.00 | - + | |
1g | 97% | in stock | $139.00 | $97.00 | - + | |
5g | 95% | in stock | $333.00 | $233.00 | - + | |
25g | 95% | in stock | $1,135.00 | $795.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50879 |
Chemical Name: | N-((3R,4R)-1-Benzyl-4-methylpiperidin-3-yl)-n-methyl-7h-pyrrolo[2,3-d]pyrimidin-4-amine |
CAS Number: | 477600-73-0 |
Molecular Formula: | C20H25N5 |
Molecular Weight: | 335.4460 |
MDL Number: | MFCD16877475 |
SMILES: | C[C@@H]1CCN(C[C@@H]1N(c1ncnc2c1cc[nH]2)C)Cc1ccccc1 |
Complexity: | 424 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.6 |
Journal of medicinal chemistry 20120628