logo
Home  > Ethyl 5-chloroindole-2-carboxylate

AB73913

4792-67-0 | Ethyl 5-chloroindole-2-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $15.00 $10.00 -   +
5g 95% in stock $16.00 $11.00 -   +
10g 95% in stock $19.00 $13.00 -   +
25g 95% in stock $37.00 $26.00 -   +
100g 95% in stock $126.00 $89.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB73913
Chemical Name: Ethyl 5-chloroindole-2-carboxylate
CAS Number: 4792-67-0
Molecular Formula: C11H10ClNO2
Molecular Weight: 223.6556
MDL Number: MFCD00005610
SMILES: CCOC(=O)c1cc2c([nH]1)ccc(c2)Cl
NSC Number: 94209

 

Computed Properties
Complexity: 247  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 3  
XLogP3: 3.8  

 

 

Upstream Synthesis Route
  • Ethyl 5-chloro-1H-indole-2-carboxylate is a versatile chemical compound that finds significant application in chemical synthesis processes. This compound serves as a key building block in the creation of various complex organic molecules through its involvement in several key synthetic pathways.One notable application of Ethyl 5-chloro-1H-indole-2-carboxylate is in the synthesis of pharmaceutical intermediates. By serving as a precursor in the production of specific drug molecules, this compound plays a crucial role in the pharmaceutical industry. Its unique structural features make it a valuable starting material for the construction of biologically active compounds with potential therapeutic benefits.Furthermore, Ethyl 5-chloro-1H-indole-2-carboxylate is utilized in the development of agrochemicals and functional materials. Its incorporation into the synthesis of pesticide intermediates and specialty chemicals demonstrates its importance in the agricultural and materials science sectors. The compound's reactivity and compatibility with various reaction conditions make it a desirable component in the design and production of advanced materials for diverse applications.In summary, Ethyl 5-chloro-1H-indole-2-carboxylate plays a crucial role in chemical synthesis by enabling the construction of complex organic molecules with pharmacological, agricultural, and material science applications. Its versatility and reactivity make it a valuable tool for researchers and scientists engaged in the development of innovative compounds for various industries.
FEATURED PRODUCTS