AB43668
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $53.00 | $37.00 | - + | |
1g | 95% | in stock | $90.00 | $63.00 | - + | |
5g | 95% | in stock | $290.00 | $203.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43668 |
Chemical Name: | 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic acid |
CAS Number: | 487-66-1 |
Molecular Formula: | C8H8O5 |
Molecular Weight: | 184.1461 |
MDL Number: | MFCD18252872 |
SMILES: | OC(=O)CCC1=C(C)C(=O)OC1=O |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
The compound 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic Acid, also known as $name$, serves as a versatile building block in chemical synthesis. Its unique structure enables it to participate in a wide range of reactions, making it a valuable tool for the creation of various compounds.In chemical synthesis, $name$ can act as a precursor for the synthesis of complex molecules due to its ability to undergo functional group transformations. Its furan ring provides a reactive site for further derivatization, allowing for the introduction of different functional groups to tailor the properties of the final product.Furthermore, $name$ can serve as a chiral building block, enabling the synthesis of enantiomerically pure compounds. This is particularly valuable in the pharmaceutical industry where the chirality of a molecule can significantly impact its biological activity and pharmacological properties.Overall, the application of 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic Acid in chemical synthesis offers a powerful tool for the creation of diverse and complex molecules with tailored properties and functionalities.