AB46395
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | in stock | $33.00 | $23.00 | - + | ||
5g | in stock | $65.00 | $45.00 | - + | ||
10g | in stock | $97.00 | $68.00 | - + | ||
25g | in stock | $145.00 | $102.00 | - + | ||
100g | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46395 |
Chemical Name: | (2S)-2-amino-3-(4-hydroxyphenyl)propanamide |
CAS Number: | 4985-46-0 |
Molecular Formula: | C9H12N2O2 |
Molecular Weight: | 180.2038 |
MDL Number: | MFCD00069935 |
SMILES: | N[C@H](C(=O)N)Cc1ccc(cc1)O |
Complexity: | 177 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | -0.6 |
Analytical chemistry 20120619
Steroids 20120401
Analytical and bioanalytical chemistry 20111201
Analytica chimica acta 20111130
Analytica chimica acta 20111114
Analytical and bioanalytical chemistry 20100801
The Journal of biological chemistry 20100312
Sensors (Basel, Switzerland) 20100101
Analytical chemistry 20090901
Biomaterials 20090701
Endocrine-related cancer 20090301
Amino acids 20090201
Analytical biochemistry 20090101
British journal of cancer 20080916
The journal of physical chemistry. B 20080529
Liver international : official journal of the International Association for the Study of the Liver 20080301
Electrophoresis 20070801
Journal of natural products 20050801
Journal of neuroscience research 20050301
Biophysical chemistry 20041001
Analytical chemistry 20040215
Biomacromolecules 20040101
Molecular diversity 20040101
Journal of medicinal chemistry 20030213
Methods in enzymology 20030101
Journal of the American Chemical Society 20020515
Bioorganic & medicinal chemistry 20011001