AB53122
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 98% | in stock | $22.00 | $15.00 | - + | |
1g | 98% | in stock | $30.00 | $21.00 | - + | |
5g | 98% | in stock | $105.00 | $73.00 | - + | |
10g | 98% | in stock | $185.00 | $129.00 | - + | |
25g | 98% | in stock | $400.00 | $280.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53122 |
Chemical Name: | 11β,17α,21-Trihydroxypregn-4-ene-3,20-dione |
CAS Number: | 50-23-7 |
Molecular Formula: | C21H30O5 |
Molecular Weight: | 362.4599 |
MDL Number: | MFCD00011654 |
SMILES: | OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C |
NSC Number: | 10483 |
Complexity: | 684 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 7 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.6 |
11β,17α,21-Trihydroxypregn-4-ene-3,20-dione is a key compound frequently utilized in chemical synthesis as a potent intermediate. This compound plays a crucial role in numerous synthetic pathways, particularly in the creation of various corticosteroids and other bioactive molecules. Due to its unique structure and reactive functional groups, 11β,17α,21-Trihydroxypregn-4-ene-3,20-dione serves as a versatile building block for the preparation of corticosteroids with tailored pharmacological properties. Its strategic placement within synthetic routes enables the efficient construction of complex steroid molecules, making it a valuable asset in the field of organic chemistry.