AI51336
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98%(HPLC) | in stock | $24.00 | $17.00 | - + | |
5g | 98%(HPLC) | in stock | $33.00 | $23.00 | - + | |
25g | 98% | in stock | $74.00 | $52.00 | - + | |
100g | 98% | in stock | $203.00 | $142.00 | - + | |
500g | 98% | in stock | $760.00 | $532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI51336 |
Chemical Name: | 2-Methoxy-5-(methylsulfonyl)benzoic acid |
CAS Number: | 50390-76-6 |
Molecular Formula: | C9H10O5S |
Molecular Weight: | 230.2377 |
MDL Number: | MFCD01317544 |
SMILES: | COc1ccc(cc1C(=O)O)S(=O)(=O)C |
Complexity: | 329 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.4 |
Journal of AOAC International 20070101