AB60473
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $74.00 | $52.00 | - + | |
5g | 98% | in stock | $251.00 | $176.00 | - + | |
10g | 98% | in stock | $387.00 | $271.00 | - + | |
25g | 98% | in stock | $760.00 | $532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60473 |
Chemical Name: | 2,5-Dimethyl-1-(4-nitrophenyl)pyrrole |
CAS Number: | 5044-22-4 |
Molecular Formula: | C12H12N2O2 |
Molecular Weight: | 216.2359 |
MDL Number: | MFCD00085038 |
SMILES: | Cc1ccc(n1c1ccc(cc1)[N+](=O)[O-])C |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
The journal of physical chemistry. B 20101216