AD25398
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $9.00 | $6.00 | - + | |
10mg | 98% | in stock | $32.00 | $22.00 | - + | |
50mg | 98% | in stock | $90.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD25398 |
Chemical Name: | GW441756 |
CAS Number: | 504433-23-2 |
Molecular Formula: | C17H13N3O |
Molecular Weight: | 275.3046 |
MDL Number: | MFCD17010281 |
SMILES: | O=C1Nc2c(C1=Cc1cn(c3c1cccc3)C)nccc2 |
Complexity: | 461 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
Experimental cell research 20151115
Journal of medicinal chemistry 20080814
Bioorganic & medicinal chemistry letters 20040223