AG29648
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $265.00 | $186.00 | - + | |
5g | 95% | in stock | $758.00 | $531.00 | - + | |
10g | 95% | in stock | $1,317.00 | $922.00 | - + | |
25g | 95% | in stock | $2,623.00 | $1,836.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG29648 |
Chemical Name: | 4-(2,6-Difluorophenyl)benzoic acid |
CAS Number: | 505082-79-1 |
Molecular Formula: | C13H8F2O2 |
Molecular Weight: | 234.1982 |
MDL Number: | MFCD18312610 |
SMILES: | Fc1cccc(c1c1ccc(cc1)C(=O)O)F |
Complexity: | 265 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.3 |
Journal of medicinal chemistry 20040115