AG24806
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | 1 week | $102.00 | $72.00 | - + | |
5mg | 99% | 1 week | $215.00 | $151.00 | - + | |
10mg | 99% | 1 week | $343.00 | $240.00 | - + | |
25mg | 99% | 1 week | $456.00 | $320.00 | - + | |
50mg | 99% | 1 week | $580.00 | $406.00 | - + | |
100mg | 99% | 1 week | $754.00 | $528.00 | - + | |
250mg | 99% | 1 week | $980.00 | $686.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG24806 |
Chemical Name: | Licarin b |
CAS Number: | 51020-87-2 |
Molecular Formula: | C20H20O4 |
Molecular Weight: | 324.3704 |
MDL Number: | MFCD13195533 |
SMILES: | C/C=C/c1cc2c(c(c1)OC)O[C@H]([C@@H]2C)c1ccc2c(c1)OCO2 |
Complexity: | 465 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.6 |
Food and chemical toxicology : an international journal published for the British Industrial Biological Research Association 20131201
Bioorganic & medicinal chemistry 20080315