AG33955
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $30.00 | $21.00 | - + | |
250mg | 95% | in stock | $53.00 | $38.00 | - + | |
500mg | 95% | in stock | $106.00 | $75.00 | - + | |
1g | 95% | in stock | $116.00 | $81.00 | - + | |
5g | 95% | in stock | $555.00 | $388.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG33955 |
Chemical Name: | tert-Butyl 9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate |
CAS Number: | 512822-34-3 |
Molecular Formula: | C13H21NO3 |
Molecular Weight: | 239.3107 |
MDL Number: | MFCD18792095 |
SMILES: | O=C(N1CC2CCCC(C1)C2=O)OC(C)(C)C |
Complexity: | 316 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 1.7 |
tert-Butyl 9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate serves as a valuable reagent in chemical synthesis processes due to its versatile applications. This compound is commonly utilized as a building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique molecular structure allows for the formation of complex molecules with enhanced biological activities and properties. By serving as a key intermediate in organic synthesis, tert-Butyl 9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate enables the efficient production of diverse compounds with potential therapeutic or industrial relevance.