AB45973
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $8.00 | $5.00 | - + | |
10g | 97% | in stock | $9.00 | $6.00 | - + | |
25g | 97% | in stock | $15.00 | $10.00 | - + | |
100g | 97% | in stock | $43.00 | $30.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45973 |
Chemical Name: | Di-tert-butyl iminodicarboxylate |
CAS Number: | 51779-32-9 |
Molecular Formula: | C10H19NO4 |
Molecular Weight: | 217.2622 |
MDL Number: | MFCD00043309 |
SMILES: | O=C(OC(C)(C)C)NC(=O)OC(C)(C)C |
NSC Number: | 131088 |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.1 |
Di-Tert-Butyl Iminodicarboxylate is a versatile compound that finds wide application in organic synthesis. As a reagent, it serves as a nitrogen source in various chemical reactions, enabling the selective preparation of a range of nitrogen-containing molecules. When used in conjunction with different catalysts or reactants, Di-Tert-Butyl Iminodicarboxylate can facilitate the formation of important functional groups, such as amines and amides, in a controlled and efficient manner. Its unique structure and reactivity make it a valuable tool for the construction of complex organic molecules in academic research and industrial settings. By harnessing the specific properties of Di-Tert-Butyl Iminodicarboxylate, chemists can design and execute innovative synthetic strategies that contribute to the advancement of drug discovery, materials science, and other areas of chemical discovery.
Analytical sciences : the international journal of the Japan Society for Analytical Chemistry 20020101