AG32804
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $82.00 | $58.00 | - + | |
250mg | 95% | in stock | $113.00 | $79.00 | - + | |
1g | 95% | in stock | $250.00 | $175.00 | - + | |
5g | 95% | in stock | $741.00 | $519.00 | - + | |
10g | 95% | in stock | $1,227.00 | $859.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG32804 |
Chemical Name: | 1,2-Dimethyl 4-aminophthalate |
CAS Number: | 51832-31-6 |
Molecular Formula: | C10H11NO4 |
Molecular Weight: | 209.1986 |
MDL Number: | MFCD00017197 |
SMILES: | COC(=O)c1cc(N)ccc1C(=O)OC |
NSC Number: | 41699 |
Complexity: | 254 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2 |
Applied biochemistry and biotechnology 20120101