AI51645
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $24.00 | $17.00 | - + | |
25g | 98% | in stock | $42.00 | $30.00 | - + | |
100g | ≥ 99% (Assay) | in stock | $68.00 | $48.00 | - + | |
250g | ≥ 99% (Assay) | in stock | $94.00 | $66.00 | - + | |
1kg | ≥ 99% (Assay) | in stock | $209.00 | $146.00 | - + | |
5kg | ≥ 99% (Assay) | in stock | $791.00 | $554.00 | - + | |
10kg | ≥ 99% (Assay) | in stock | $1,454.00 | $1,018.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI51645 |
Chemical Name: | L-Ornithine, 2-oxopentanedioate (1:1)OTHER CA INDEX NAMES:Pentanedioic acid, 2-oxo-, compd. with L-ornithine (1:1) |
CAS Number: | 5191-97-9 |
Molecular Formula: | C10H18N2O7 |
Molecular Weight: | 278.2591 |
MDL Number: | MFCD00091882 |
SMILES: | OC(=O)CCC(=O)C(=O)O.NCCC[C@@H](C(=O)O)N |