logo
Home  > S-1-Cbz-pyrrolidine-2-carboxylic acid methyl ester

AB77872

5211-23-4 | S-1-Cbz-pyrrolidine-2-carboxylic acid methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $8.00 $5.00 -   +
5g 95% in stock $9.00 $6.00 -   +
10g 95% in stock $16.00 $11.00 -   +
25g 95% in stock $23.00 $16.00 -   +
100g 95% in stock $73.00 $51.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB77872
Chemical Name: S-1-Cbz-pyrrolidine-2-carboxylic acid methyl ester
CAS Number: 5211-23-4
Molecular Formula: C14H17NO4
Molecular Weight: 263.2891
MDL Number: MFCD00134246
SMILES: COC(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1

 

Upstream Synthesis Route
  • The (S)-1-Benzyl 2-methyl pyrrolidine-1,2-dicarboxylate, also known as $name$, serves as a valuable reagent in chemical synthesis, particularly in the field of asymmetric synthesis. This compound, with its unique structure and chirality, plays a crucial role in the development of enantioselective processes.$name$ is commonly used as a chiral auxiliary in various transformations, such as asymmetric Michael additions, Diels-Alder reactions, and aldol condensations. Its presence helps to control the stereochemistry of the reactions, leading to the formation of enantiomerically pure products. By exploiting the chirality provided by $name$, chemists can efficiently access molecules with high optical purity, which is essential in the pharmaceutical and agrochemical industries.Furthermore, $name$ has found applications in the synthesis of natural products and complex molecules where chiral centers are abundant. Its ability to induce asymmetry in chemical reactions makes it a versatile tool for designing efficient and selective synthetic routes.In summary, the (S)-1-Benzyl 2-methyl pyrrolidine-1,2-dicarboxylate, $name$, is a valuable reagent that enables chemists to perform asymmetric synthesis with precision and control, opening new avenues for the creation of chiral compounds with high enantiomeric purity.
FEATURED PRODUCTS