AG16640
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $36.00 | $25.00 | - + | |
5g | 95% | in stock | $90.00 | $63.00 | - + | |
10g | 95% | in stock | $139.00 | $97.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG16640 |
Chemical Name: | 1-(1H-Benzo[d]imidazol-2-yl)guanidine |
CAS Number: | 5418-95-1 |
Molecular Formula: | C8H9N5 |
Molecular Weight: | 175.1906 |
MDL Number: | MFCD00005590 |
SMILES: | NC(=N)Nc1nc2c([nH]1)cccc2 |
NSC Number: | 10548 |
Complexity: | 211 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.1 |
European journal of medicinal chemistry 20120101
Journal of analytical methods in chemistry 20120101
Bioorganic & medicinal chemistry letters 20101101
Journal of inorganic biochemistry 20090901
The Journal of membrane biology 20030901
The Journal of membrane biology 20011201