AB79327
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $16.00 | $12.00 | - + | |
10g | 98% | in stock | $20.00 | $14.00 | - + | |
25g | 98% | in stock | $25.00 | $18.00 | - + | |
100g | 98% | in stock | $86.00 | $61.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79327 |
Chemical Name: | 4-N-Boc-aminophenol |
CAS Number: | 54840-15-2 |
Molecular Formula: | C11H15NO3 |
Molecular Weight: | 209.2417 |
MDL Number: | MFCD00226573 |
SMILES: | O=C(Nc1ccc(cc1)O)OC(C)(C)C |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.9 |
European journal of medicinal chemistry 20110501