logo
Home  > Life Science  > APIs  > API  > Liothyronin sodium

AB75138

55-06-1 | Liothyronin sodium

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $13.00 $9.00 -   +
25mg 95% in stock $19.00 $13.00 -   +
100mg 95% in stock $23.00 $16.00 -   +
250mg 95% in stock $28.00 $20.00 -   +
1g 95% in stock $80.00 $56.00 -   +
5g 95% in stock $339.00 $238.00 -   +
25g 95% in stock $1,319.00 $923.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB75138
Chemical Name: Liothyronin sodium
CAS Number: 55-06-1
Molecular Formula: C15H11I3NNaO4
Molecular Weight: 672.9553
MDL Number: MFCD00002594
SMILES: [O-]C(=O)[C@H](Cc1cc(I)c(c(c1)I)Oc1ccc(c(c1)I)O)N.[Na+]

 

Upstream Synthesis Route
  • The application of L-Tyrosine, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-, sodium salt (1:1) in chemical synthesis lies in its unique structure and properties. This compound serves as a versatile building block in organic synthesis, particularly in the creation of pharmaceuticals, dyes, and specialty chemicals. Due to the presence of the tyrosine moiety, which contains both a phenol and an amine group, this compound can participate in a variety of chemical reactions such as halogenation, acylation, and coupling reactions. Additionally, the presence of iodine atoms in its structure further enhances its reactivity, making it a valuable precursor in the synthesis of complex organic molecules. The sodium salt form of this compound also provides improved solubility and stability in aqueous environments, expanding its utility in various synthetic pathways. Overall, L-Tyrosine, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-, sodium salt (1:1) plays a crucial role in modern chemical synthesis by enabling the efficient construction of diverse organic compounds with specific biological or pharmaceutical activities.
FEATURED PRODUCTS