AB72265
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $45.00 | $32.00 | - + | |
200mg | 95% | in stock | $82.00 | $58.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB72265 |
Chemical Name: | 11-oxo-2,3,5,6,7,11-Hexahydro-1H-pyrano[2,3-f]pyrido[3,2,1-ij]quinoline-10-carboxylic acid |
CAS Number: | 55804-65-4 |
Molecular Formula: | C16H15NO4 |
Molecular Weight: | 285.2946 |
MDL Number: | MFCD00051335 |
SMILES: | OC(=O)c1cc2cc3CCCN4c3c(c2oc1=O)CCC4 |
Complexity: | 514 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.1 |
Bioorganic & medicinal chemistry 20131115
Chemical communications (Cambridge, England) 20120518
Chemphyschem : a European journal of chemical physics and physical chemistry 20120514
The Journal of chemical physics 20120321
The journal of physical chemistry. A 20110929
Physical chemistry chemical physics : PCCP 20101114
The journal of physical chemistry. A 20100715