logo
Home  > Life Science  > DNA/RNA  > Nucleosides & Nucleotides  > Adenosine triphosphate

AB50954

56-65-5 | Adenosine triphosphate

Packsize Purity Availability Price Discounted Price    Quantity
5g 95% in stock $24.00 $17.00 -   +
25g 95% in stock $62.00 $44.00 -   +
100g 95% in stock $185.00 $130.00 -   +
500g 95% in stock $712.00 $498.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB50954
Chemical Name: Adenosine triphosphate
CAS Number: 56-65-5
Molecular Formula: C10H16N5O13P3
Molecular Weight: 507.181
MDL Number: MFCD00065467
SMILES: O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)O)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N

 

Computed Properties
Complexity: 800  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 4  
Heavy Atom Count: 31  
Hydrogen Bond Acceptor Count: 17  
Hydrogen Bond Donor Count: 7  
Rotatable Bond Count: 8  
XLogP3: -5.7  

 

 

Upstream Synthesis Route
  • Adenosine triphosphate (ATP) plays a crucial role in chemical synthesis as a high-energy molecule that provides the necessary energy for various biochemical reactions. In organic chemistry, ATP is utilized as a coenzyme and a source of phosphate groups in enzymatic reactions. ATP is often involved in phosphorylation reactions, where a phosphate group from ATP is transferred to another molecule, activating or deactivating it. This process is essential for the synthesis of complex molecules and the transportation of chemical compounds within cells. Additionally, ATP serves as a key component in facilitating energy transfer within biological systems, making it a vital element in the overall process of chemical synthesis.
FEATURED PRODUCTS