AB50954
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $24.00 | $17.00 | - + | |
25g | 95% | in stock | $62.00 | $44.00 | - + | |
100g | 95% | in stock | $185.00 | $130.00 | - + | |
500g | 95% | in stock | $712.00 | $498.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50954 |
Chemical Name: | Adenosine triphosphate |
CAS Number: | 56-65-5 |
Molecular Formula: | C10H16N5O13P3 |
Molecular Weight: | 507.181 |
MDL Number: | MFCD00065467 |
SMILES: | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)O)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N |
Complexity: | 800 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 17 |
Hydrogen Bond Donor Count: | 7 |
Rotatable Bond Count: | 8 |
XLogP3: | -5.7 |
Adenosine triphosphate (ATP) plays a crucial role in chemical synthesis as a high-energy molecule that provides the necessary energy for various biochemical reactions. In organic chemistry, ATP is utilized as a coenzyme and a source of phosphate groups in enzymatic reactions. ATP is often involved in phosphorylation reactions, where a phosphate group from ATP is transferred to another molecule, activating or deactivating it. This process is essential for the synthesis of complex molecules and the transportation of chemical compounds within cells. Additionally, ATP serves as a key component in facilitating energy transfer within biological systems, making it a vital element in the overall process of chemical synthesis.