AB75010
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $22.00 | $15.00 | - + | |
10g | 98% | in stock | $42.00 | $29.00 | - + | |
25g | 98% | in stock | $103.00 | $72.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75010 |
Chemical Name: | L-3-Cyanophenylalanine |
CAS Number: | 57213-48-6 |
Molecular Formula: | C10H10N2O2 |
Molecular Weight: | 190.1986 |
MDL Number: | MFCD01860885 |
SMILES: | N#Cc1cccc(c1)C[C@@H](C(=O)O)N |
Complexity: | 256 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.8 |
The journal of physical chemistry. B 20101028