AB65824
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $23.00 | $16.00 | - + | |
250mg | 95% | in stock | $38.00 | $26.00 | - + | |
1g | 95% | in stock | $50.00 | $35.00 | - + | |
25g | 95% | in stock | $1,246.00 | $872.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB65824 |
Chemical Name: | 4-(4-Fluorophenyl)benzoic acid |
CAS Number: | 5731-10-2 |
Molecular Formula: | C13H9FO2 |
Molecular Weight: | 216.20776320000002 |
MDL Number: | MFCD01631909 |
SMILES: | Fc1ccc(cc1)c1ccc(cc1)C(=O)O |
Complexity: | 238 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.7 |
Nature 20050602
Journal of medicinal chemistry 20040115