AB50942
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $42.00 | $29.00 | - + | |
25mg | 98% | in stock | $130.00 | $91.00 | - + | |
50mg | 98% | in stock | $228.00 | $160.00 | - + | |
100mg | 98% | in stock | $380.00 | $266.00 | - + | |
250mg | 98% | in stock | $888.00 | $622.00 | - + | |
1g | 98% | in stock | $2,664.00 | $1,865.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50942 |
Chemical Name: | methyl (2E)-3-{3-[N-({4-[4-(dimethylamino)phenyl]phenyl}methyl)cyclohexaneamido]phenyl}prop-2-enoate |
CAS Number: | 574013-66-4 |
Molecular Formula: | C32H36N2O3 |
Molecular Weight: | 496.6398 |
MDL Number: | MFCD09971007 |
SMILES: | COC(=O)/C=C/c1cccc(c1)N(C(=O)C1CCCCC1)Cc1ccc(cc1)c1ccc(cc1)N(C)C |
Complexity: | 743 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 37 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 9 |
XLogP3: | 6.9 |
Bioorganic & medicinal chemistry letters 20121115
Yao xue xue bao = Acta pharmaceutica Sinica 20120601
American journal of physiology. Gastrointestinal and liver physiology 20090701
American journal of physiology. Regulatory, integrative and comparative physiology 20070901
Bioorganic & medicinal chemistry letters 20070415
Expert opinion on investigational drugs 20040901
Molecular cell 20030401
Drug metabolism and disposition: the biological fate of chemicals 19750101