AG69005
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $54.00 | $38.00 | - + | |
100mg | 98% | in stock | $117.00 | $82.00 | - + | |
250mg | 98% | in stock | $226.00 | $159.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG69005 |
Chemical Name: | Brl 54443 |
CAS Number: | 57477-39-1 |
Molecular Formula: | C14H18N2O |
Molecular Weight: | 230.3055 |
MDL Number: | MFCD01861184 |
SMILES: | CN1CCC(CC1)c1c[nH]c2c1cc(O)cc2 |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.5 |
The Journal of biological chemistry 20020419