AB45639
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $19.00 | $14.00 | - + | |
10g | 98% | in stock | $29.00 | $21.00 | - + | |
25g | 98% | in stock | $55.00 | $39.00 | - + | |
100g | 98% | in stock | $205.00 | $144.00 | - + | |
500g | 98% | in stock | $1,008.00 | $706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45639 |
Chemical Name: | Bis(pentafluorophenyl)carbonate |
CAS Number: | 59483-84-0 |
Molecular Formula: | C13F10O3 |
Molecular Weight: | 394.1213 |
MDL Number: | MFCD00368353 |
SMILES: | O=C(Oc1c(F)c(F)c(c(c1F)F)F)Oc1c(F)c(F)c(c(c1F)F)F |
Complexity: | 439 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 13 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.6 |
Bis(perfluorophenyl)carbonate is a highly versatile compound used in various chemical synthesis applications. As a reactive difunctional carbonate, it serves as an effective crosslinking agent in polymer chemistry, enabling the formation of intricate networks through polycondensation reactions. Due to its perfluorinated phenyl groups, this compound exhibits exceptional compatibility with fluorochemical materials, making it an ideal choice for producing specialty polymers with enhanced chemical and thermal stability. In addition, Bis(perfluorophenyl)carbonate is employed as a reagent for the functionalization of surfaces, enabling the modification of substrates to impart desirable properties such as improved wettability and adhesion. Its unique structure and reactivity make it a valuable tool in synthetic chemistry for creating advanced materials with tailored properties.