AI53322
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $12.00 | - + | |
5g | 98% | in stock | $42.00 | $30.00 | - + | |
25g | 98% | in stock | $131.00 | $92.00 | - + | |
100g | 98% | in stock | $523.00 | $366.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI53322 |
Chemical Name: | N-(4-Nitrobenzoyl)-beta-alanine |
CAS Number: | 59642-21-6 |
Molecular Formula: | C10H10N2O5 |
Molecular Weight: | 238.1968 |
MDL Number: | MFCD00009794 |
SMILES: | OC(=O)CCNC(=O)c1ccc(cc1)N(=O)=O |
Complexity: | 304 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.5 |
Journal of medicinal chemistry 20110113