AI53342
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 102% | in stock | $58.00 | $41.00 | - + | |
5g | 102% | in stock | $95.00 | $66.00 | - + | |
25g | 102% | in stock | $263.00 | $184.00 | - + | |
100g | 102% | in stock | $650.00 | $455.00 | - + | |
250g | 102% | in stock | $1,221.00 | $855.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI53342 |
Chemical Name: | (S)-1-(3-(dimethylamino)propyl)-1-(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile hydrobromide |
CAS Number: | 59729-32-7 |
Molecular Formula: | C20H22BrFN2O |
Molecular Weight: | 405.3039 |
MDL Number: | MFCD02101306 |
SMILES: | N#Cc1ccc2c(c1)COC2(CCCN(C)C)c1ccc(cc1)F.Br |
Citalopram hydrobromide, a selective serotonin reuptake inhibitor (SSRI), is commonly used in chemical synthesis as a key intermediate in the production of pharmaceuticals and other organic compounds. Its unique chemical properties make it a valuable building block for the synthesis of various drugs, including antidepressants and anti-anxiety medications. In addition, Citalopram hydrobromide can be utilized in research and development processes to explore new therapeutic agents and study neurotransmitter pathways. Its role in chemical synthesis contributes to the advancement of medical science and pharmacological innovation.