AB42621
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $23.00 | $17.00 | - + | |
5g | 97% | in stock | $94.00 | $66.00 | - + | |
10g | 97% | in stock | $163.00 | $114.00 | - + | |
25g | 97% | in stock | $316.00 | $222.00 | - + | |
100g | 97% | in stock | $1,261.00 | $883.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42621 |
Chemical Name: | Methyl (S)-(-)-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
CAS Number: | 60456-21-5 |
Molecular Formula: | C7H12O4 |
Molecular Weight: | 160.1678 |
MDL Number: | MFCD00066526 |
SMILES: | COC(=O)[C@@H]1COC(O1)(C)C |
Complexity: | 164 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.4 |
The Journal of organic chemistry 20010601