AG64427
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
25g | 95% | in stock | $22.00 | $15.00 | - + | |
100g | 95% | in stock | $75.00 | $52.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG64427 |
Chemical Name: | Z-D-Ser-OH |
CAS Number: | 6081-61-4 |
Molecular Formula: | C11H13NO5 |
Molecular Weight: | 239.2246 |
MDL Number: | MFCD00063144 |
SMILES: | OC[C@H](C(=O)O)N=C(OCc1ccccc1)O |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.4 |
Journal of medicinal chemistry 20120524
European journal of medicinal chemistry 20070301
Organic letters 19990909