AA67803
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $8.00 | $6.00 | - + | |
25g | 97% | in stock | $22.00 | $16.00 | - + | |
100g | 97% | in stock | $87.00 | $61.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA67803 |
Chemical Name: | L-Xylose |
CAS Number: | 609-06-3 |
Molecular Formula: | C5H10O5 |
Molecular Weight: | 150.1299 |
MDL Number: | MFCD00151096 |
SMILES: | OC[C@@H]([C@H]([C@@H](C=O)O)O)O |
Complexity: | 104 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | -2.3 |
The Journal of biological chemistry 20020920
Bioorganic & medicinal chemistry letters 20020902
The Journal of membrane biology 19950101